C32H32BN5O4 — CID 123204941
CID 123204941 (PubChem CID 123204941) has the molecular formula C32H32BN5O4 and a molecular weight of 561.45 g/mol.
| Compound Name | CID 123204941 |
|---|---|
| PubChem CID | 123204941 |
| Molecular Formula | C32H32BN5O4 |
| Molecular Weight | 561.45 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | — |
| SMILES | [B]c1ccc2c(CN3C(=O)C(NC(=O)C(C)NC)CN(C(=O)c4ccc(N)cc4)c4ccccc43)c(OC)ccc2c1 |
| InChI | InChI=1S/C32H32BN5O4/c1-19(35-2)30(39)36-26-18-38(31(40)20-8-12-23(34)13-9-20)28-7-5-4-6-27(28)37(32(26)41)17-25-24-14-11-22(33)16-21(24)10-15-29(25)42-3/h4-16,19,26,35H,17-18,34H2,1-3H3,(H,36,39) |
| InChIKey | AHADFXYDJUTQBV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|