About N-(1,2-difluoroprop-1-enyl)ethanimine
N-(1,2-difluoroprop-1-enyl)ethanimine (PubChem CID 123205585) has the molecular formula C5H7F2N
and a molecular weight of 119.11 g/mol. Its IUPAC name is N-(1,2-difluoroprop-1-enyl)ethanimine.
Molecular Properties
| Compound Name | N-(1,2-difluoroprop-1-enyl)ethanimine |
| PubChem CID | 123205585 |
| Molecular Formula | C5H7F2N |
| Molecular Weight | 119.11 g/mol |
| Exact Mass | 119.05 |
| IUPAC Name | N-(1,2-difluoroprop-1-enyl)ethanimine |
| SMILES | CC=NC(F)=C(C)F |
| InChI | InChI=1S/C5H7F2N/c1-3-8-5(7)4(2)6/h3H,1-2H3 |
| InChIKey | AVJUIGAZOSDRII-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.11 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(1,2-difluoroprop-1-enyl)ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,2-difluoroprop-1-enyl)ethanimine?
The IUPAC name of N-(1,2-difluoroprop-1-enyl)ethanimine (CID 123205585) is N-(1,2-difluoroprop-1-enyl)ethanimine.
What is the SMILES notation for N-(1,2-difluoroprop-1-enyl)ethanimine?
The canonical SMILES for N-(1,2-difluoroprop-1-enyl)ethanimine is CC=NC(F)=C(C)F.
What is the InChIKey of N-(1,2-difluoroprop-1-enyl)ethanimine?
The InChIKey is AVJUIGAZOSDRII-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7F2N/c1-3-8-5(7)4(2)6/h3H,1-2H3.
What are the key properties of N-(1,2-difluoroprop-1-enyl)ethanimine?
N-(1,2-difluoroprop-1-enyl)ethanimine has a molecular weight of 119.11 g/mol, XLogP of 2.21, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,2-difluoroprop-1-enyl)ethanimine is sourced from PubChem (CID 123205585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).