C27H32F2N5O+ — CID 123205799
2-ethyl-3,6-difluoro-N-[2-[4-(4-methylpyrazin-4-ium-2-yl)piperazin-1-yl]-4-propan-2-ylphenyl]benzamide (PubChem CID 123205799) has the molecular formula C27H32F2N5O+ and a molecular weight of 480.58 g/mol. Its IUPAC name is 2-ethyl-3,6-difluoro-N-[2-[4-(4-methylpyrazin-4-ium-2-yl)piperazin-1-yl]-4-propan-2-ylphenyl]benzamide.
| Compound Name | 2-ethyl-3,6-difluoro-N-[2-[4-(4-methylpyrazin-4-ium-2-yl)piperazin-1-yl]-4-propan-2-ylphenyl]benzamide |
|---|---|
| PubChem CID | 123205799 |
| Molecular Formula | C27H32F2N5O+ |
| Molecular Weight | 480.58 g/mol |
| Exact Mass | 480.26 |
| IUPAC Name | 2-ethyl-3,6-difluoro-N-[2-[4-(4-methylpyrazin-4-ium-2-yl)piperazin-1-yl]-4-propan-2-ylphenyl]benzamide |
| SMILES | CCc1c(F)ccc(F)c1C(=O)Nc1ccc(C(C)C)cc1N1CCN(c2c[n+](C)ccn2)CC1 |
| InChI | InChI=1S/C27H31F2N5O/c1-5-20-21(28)7-8-22(29)26(20)27(35)31-23-9-6-19(18(2)3)16-24(23)33-12-14-34(15-13-33)25-17-32(4)11-10-30-25/h6-11,16-18H,5,12-15H2,1-4H3/p+1 |
| InChIKey | DKODXGRJSPLNJT-UHFFFAOYSA-O |
| XLogP | 4.45 |
| TPSA | 52.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|