C25H45N — CID 123205816
5-butan-2-ylidene-N,9-dimethyl-N-[2-(2-propylcyclobutyl)ethyl]deca-7,9-dien-3-amine (PubChem CID 123205816) has the molecular formula C25H45N and a molecular weight of 359.64 g/mol. Its IUPAC name is 5-butan-2-ylidene-N,9-dimethyl-N-[2-(2-propylcyclobutyl)ethyl]deca-7,9-dien-3-amine.
| Compound Name | 5-butan-2-ylidene-N,9-dimethyl-N-[2-(2-propylcyclobutyl)ethyl]deca-7,9-dien-3-amine |
|---|---|
| PubChem CID | 123205816 |
| Molecular Formula | C25H45N |
| Molecular Weight | 359.64 g/mol |
| Exact Mass | 359.36 |
| IUPAC Name | 5-butan-2-ylidene-N,9-dimethyl-N-[2-(2-propylcyclobutyl)ethyl]deca-7,9-dien-3-amine |
| SMILES | C=C(C)C=CCC(CC(CC)N(C)CCC1CCC1CCC)=C(C)CC |
| InChI | InChI=1S/C25H45N/c1-8-12-22-15-16-23(22)17-18-26(7)25(10-3)19-24(21(6)9-2)14-11-13-20(4)5/h11,13,22-23,25H,4,8-10,12,14-19H2,1-3,5-7H3 |
| InChIKey | OKYFLECZXWAFSV-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.64 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|