About 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine
4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine (PubChem CID 123206229) has the molecular formula C11H12N2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine.
Molecular Properties
| Compound Name | 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine |
| PubChem CID | 123206229 |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.10 |
| IUPAC Name | 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine |
| SMILES | CC1C=CC(c2ccncn2)=CC1 |
| InChI | InChI=1S/C11H12N2/c1-9-2-4-10(5-3-9)11-6-7-12-8-13-11/h2,4-9H,3H2,1H3 |
| InChIKey | RQQKPOAWHXIOCJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine?
The IUPAC name of 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine (CID 123206229) is 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine.
What is the SMILES notation for 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine?
The canonical SMILES for 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine is CC1C=CC(c2ccncn2)=CC1.
What is the InChIKey of 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine?
The InChIKey is RQQKPOAWHXIOCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2/c1-9-2-4-10(5-3-9)11-6-7-12-8-13-11/h2,4-9H,3H2,1H3.
What are the key properties of 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine?
4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine has a molecular weight of 172.23 g/mol, XLogP of 2.46, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylcyclohexa-1,5-dien-1-yl)pyrimidine is sourced from PubChem (CID 123206229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).