C13H16N4O3 — CID 123206637
15-hydroxy-14-methyl-2,8,12,14-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-3,5-diene-7,13-dione (PubChem CID 123206637) has the molecular formula C13H16N4O3 and a molecular weight of 276.30 g/mol. Its IUPAC name is 15-hydroxy-14-methyl-2,8,12,14-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-3,5-diene-7,13-dione.
| Compound Name | 15-hydroxy-14-methyl-2,8,12,14-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-3,5-diene-7,13-dione |
|---|---|
| PubChem CID | 123206637 |
| Molecular Formula | C13H16N4O3 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | 15-hydroxy-14-methyl-2,8,12,14-tetrazatetracyclo[8.6.0.02,6.011,15]hexadeca-3,5-diene-7,13-dione |
| SMILES | CN1C(=O)NC2C3CNC(=O)c4cccn4C3CC21O |
| InChI | InChI=1S/C13H16N4O3/c1-16-12(19)15-10-7-6-14-11(18)8-3-2-4-17(8)9(7)5-13(10,16)20/h2-4,7,9-10,20H,5-6H2,1H3,(H,14,18)(H,15,19) |
| InChIKey | SZVTZDKNCUADJA-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |