About N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine
N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine (PubChem CID 123207374) has the molecular formula C12H27N3
and a molecular weight of 213.37 g/mol. Its IUPAC name is N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine.
Molecular Properties
| Compound Name | N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine |
| PubChem CID | 123207374 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine |
| SMILES | C/N=C/CCNCCCC(C)CCNC |
| InChI | InChI=1S/C12H27N3/c1-12(7-11-14-3)6-4-9-15-10-5-8-13-2/h8,12,14-15H,4-7,9-11H2,1-3H3/b13-8+ |
| InChIKey | SFJDCMDLGMKBTO-MDWZMJQESA-N |
| XLogP | 1.69 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine?
The IUPAC name of N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine (CID 123207374) is N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine.
What is the SMILES notation for N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine?
The canonical SMILES for N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine is C/N=C/CCNCCCC(C)CCNC.
What is the InChIKey of N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine?
The InChIKey is SFJDCMDLGMKBTO-MDWZMJQESA-N. The full InChI is InChI=1S/C12H27N3/c1-12(7-11-14-3)6-4-9-15-10-5-8-13-2/h8,12,14-15H,4-7,9-11H2,1-3H3/b13-8+.
What are the key properties of N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine?
N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine has a molecular weight of 213.37 g/mol, XLogP of 1.69, 10 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,3-dimethyl-N'-(3-methyliminopropyl)hexane-1,6-diamine is sourced from PubChem (CID 123207374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).