C14H25N7 — CID 123207635
1-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-N-[2-(dimethylamino)ethyl]-3-N-methylpropanediimidamide (PubChem CID 123207635) has the molecular formula C14H25N7 and a molecular weight of 291.40 g/mol. Its IUPAC name is 1-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-N-[2-(dimethylamino)ethyl]-3-N-methylpropanediimidamide.
| Compound Name | 1-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-N-[2-(dimethylamino)ethyl]-3-N-methylpropanediimidamide |
|---|---|
| PubChem CID | 123207635 |
| Molecular Formula | C14H25N7 |
| Molecular Weight | 291.40 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 1-N'-(5-cyclopropyl-1H-pyrazol-3-yl)-3-N-[2-(dimethylamino)ethyl]-3-N-methylpropanediimidamide |
| SMILES | [H]/N=C(/C/C(N)=N/c1cc(C2CC2)[nH]n1)N(C)CCN(C)C |
| InChI | InChI=1S/C14H25N7/c1-20(2)6-7-21(3)13(16)9-12(15)17-14-8-11(18-19-14)10-4-5-10/h8,10,16H,4-7,9H2,1-3H3,(H3,15,17,18,19)/b16-13- |
| InChIKey | HGXPDLVBGAPEAM-SSZFMOIBSA-N |
| XLogP | 1.14 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|