C42H44 — CID 123207711
9-tert-butyl-2-(3,5-ditert-butylphenyl)-10-naphthalen-1-ylanthracene (PubChem CID 123207711) has the molecular formula C42H44 and a molecular weight of 548.81 g/mol. Its IUPAC name is 9-tert-butyl-2-(3,5-ditert-butylphenyl)-10-naphthalen-1-ylanthracene.
| Compound Name | 9-tert-butyl-2-(3,5-ditert-butylphenyl)-10-naphthalen-1-ylanthracene |
|---|---|
| PubChem CID | 123207711 |
| Molecular Formula | C42H44 |
| Molecular Weight | 548.81 g/mol |
| Exact Mass | 548.34 |
| IUPAC Name | 9-tert-butyl-2-(3,5-ditert-butylphenyl)-10-naphthalen-1-ylanthracene |
| SMILES | CC(C)(C)c1cc(-c2ccc3c(-c4cccc5ccccc45)c4ccccc4c(C(C)(C)C)c3c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C42H44/c1-40(2,3)30-23-29(24-31(26-30)41(4,5)6)28-21-22-35-37(25-28)39(42(7,8)9)36-19-13-12-18-34(36)38(35)33-20-14-16-27-15-10-11-17-32(27)33/h10-26H,1-9H3 |
| InChIKey | WQXGZRKDWCPCOC-UHFFFAOYSA-N |
| XLogP | 12.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.81 |
| LogP ≤ 5 | 12.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|