C20H22N2O3 — CID 123208013
ethyl 4-(1-acetyl-4-amino-3,4-dihydro-2H-quinolin-6-yl)benzoate (PubChem CID 123208013) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is ethyl 4-(1-acetyl-4-amino-3,4-dihydro-2H-quinolin-6-yl)benzoate.
| Compound Name | ethyl 4-(1-acetyl-4-amino-3,4-dihydro-2H-quinolin-6-yl)benzoate |
|---|---|
| PubChem CID | 123208013 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethyl 4-(1-acetyl-4-amino-3,4-dihydro-2H-quinolin-6-yl)benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc3c(c2)C(N)CCN3C(C)=O)cc1 |
| InChI | InChI=1S/C20H22N2O3/c1-3-25-20(24)15-6-4-14(5-7-15)16-8-9-19-17(12-16)18(21)10-11-22(19)13(2)23/h4-9,12,18H,3,10-11,21H2,1-2H3 |
| InChIKey | FWPPSMNODUBCIM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |