C27H28ClNO6 — CID 123209220
methyl 7'-chloro-4'-methoxy-6',7-dimethyl-3',5-dioxo-4-phenylspiro[1,2,3,4,4a,6,7,8a-octahydroquinoline-8,2'-1-benzofuran]-2-carboxylate (PubChem CID 123209220) has the molecular formula C27H28ClNO6 and a molecular weight of 497.98 g/mol. Its IUPAC name is methyl 7'-chloro-4'-methoxy-6',7-dimethyl-3',5-dioxo-4-phenylspiro[1,2,3,4,4a,6,7,8a-octahydroquinoline-8,2'-1-benzofuran]-2-carboxylate.
| Compound Name | methyl 7'-chloro-4'-methoxy-6',7-dimethyl-3',5-dioxo-4-phenylspiro[1,2,3,4,4a,6,7,8a-octahydroquinoline-8,2'-1-benzofuran]-2-carboxylate |
|---|---|
| PubChem CID | 123209220 |
| Molecular Formula | C27H28ClNO6 |
| Molecular Weight | 497.98 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | methyl 7'-chloro-4'-methoxy-6',7-dimethyl-3',5-dioxo-4-phenylspiro[1,2,3,4,4a,6,7,8a-octahydroquinoline-8,2'-1-benzofuran]-2-carboxylate |
| SMILES | COC(=O)C1CC(c2ccccc2)C2C(=O)CC(C)C3(Oc4c(Cl)c(C)cc(OC)c4C3=O)C2N1 |
| InChI | InChI=1S/C27H28ClNO6/c1-13-10-19(33-3)21-23(22(13)28)35-27(25(21)31)14(2)11-18(30)20-16(15-8-6-5-7-9-15)12-17(26(32)34-4)29-24(20)27/h5-10,14,16-17,20,24,29H,11-12H2,1-4H3 |
| InChIKey | RDDYNLABFFMNJU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.98 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |