About 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole
5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole (PubChem CID 123209662) has the molecular formula C7H9N3S
and a molecular weight of 167.24 g/mol. Its IUPAC name is 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole.
Molecular Properties
| Compound Name | 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole |
| PubChem CID | 123209662 |
| Molecular Formula | C7H9N3S |
| Molecular Weight | 167.24 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole |
| SMILES | CCc1nc2sc(C)nc2[nH]1 |
| InChI | InChI=1S/C7H9N3S/c1-3-5-9-6-7(10-5)11-4(2)8-6/h3H2,1-2H3,(H,9,10) |
| InChIKey | ULIGXHDHQGELAT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.24 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole?
The IUPAC name of 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole (CID 123209662) is 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole.
What is the SMILES notation for 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole?
The canonical SMILES for 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole is CCc1nc2sc(C)nc2[nH]1.
What is the InChIKey of 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole?
The InChIKey is ULIGXHDHQGELAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9N3S/c1-3-5-9-6-7(10-5)11-4(2)8-6/h3H2,1-2H3,(H,9,10).
What are the key properties of 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole?
5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole has a molecular weight of 167.24 g/mol, XLogP of 1.89, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-methyl-4H-imidazo[4,5-d][1,3]thiazole is sourced from PubChem (CID 123209662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).