About ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate
ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate (PubChem CID 123209711) has the molecular formula C12H17NO4
and a molecular weight of 239.27 g/mol. Its IUPAC name is ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate.
Molecular Properties
| Compound Name | ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate |
| PubChem CID | 123209711 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate |
| SMILES | CCOC(=O)CC=C1C2N1C(=O)OCC2(C)C |
| InChI | InChI=1S/C12H17NO4/c1-4-16-9(14)6-5-8-10-12(2,3)7-17-11(15)13(8)10/h5,10H,4,6-7H2,1-3H3 |
| InChIKey | CELSUROERXNMJR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate?
The IUPAC name of ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate (CID 123209711) is ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate.
What is the SMILES notation for ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate?
The canonical SMILES for ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate is CCOC(=O)CC=C1C2N1C(=O)OCC2(C)C.
What is the InChIKey of ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate?
The InChIKey is CELSUROERXNMJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO4/c1-4-16-9(14)6-5-8-10-12(2,3)7-17-11(15)13(8)10/h5,10H,4,6-7H2,1-3H3.
What are the key properties of ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate?
ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate has a molecular weight of 239.27 g/mol, XLogP of 1.68, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(5,5-dimethyl-2-oxo-3-oxa-1-azabicyclo[4.1.0]heptan-7-ylidene)propanoate is sourced from PubChem (CID 123209711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).