C25H27BO6 — CID 123209962
4-hydroxy-3-(3-oxo-1-phenylbutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one (PubChem CID 123209962) has the molecular formula C25H27BO6 and a molecular weight of 434.30 g/mol. Its IUPAC name is 4-hydroxy-3-(3-oxo-1-phenylbutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one.
| Compound Name | 4-hydroxy-3-(3-oxo-1-phenylbutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one |
|---|---|
| PubChem CID | 123209962 |
| Molecular Formula | C25H27BO6 |
| Molecular Weight | 434.30 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | 4-hydroxy-3-(3-oxo-1-phenylbutyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)chromen-2-one |
| SMILES | CC(=O)CC(c1ccccc1)c1c(O)c2cc(B3OC(C)(C)C(C)(C)O3)ccc2oc1=O |
| InChI | InChI=1S/C25H27BO6/c1-15(27)13-18(16-9-7-6-8-10-16)21-22(28)19-14-17(11-12-20(19)30-23(21)29)26-31-24(2,3)25(4,5)32-26/h6-12,14,18,28H,13H2,1-5H3 |
| InChIKey | GWHOVHKYIORDLR-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|