About 2H-pyrido[1,2-a]quinoxaline-3-carboxamide
2H-pyrido[1,2-a]quinoxaline-3-carboxamide (PubChem CID 123210452) has the molecular formula C13H11N3O
and a molecular weight of 225.25 g/mol. Its IUPAC name is 2H-pyrido[1,2-a]quinoxaline-3-carboxamide.
Molecular Properties
| Compound Name | 2H-pyrido[1,2-a]quinoxaline-3-carboxamide |
| PubChem CID | 123210452 |
| Molecular Formula | C13H11N3O |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | 2H-pyrido[1,2-a]quinoxaline-3-carboxamide |
| SMILES | NC(=O)C1=CC2=NC=C3C=CC=CN3C2=CC1 |
| InChI | InChI=1S/C13H11N3O/c14-13(17)9-4-5-12-11(7-9)15-8-10-3-1-2-6-16(10)12/h1-3,5-8H,4H2,(H2,14,17) |
| InChIKey | NSVSYQSKOOSKBF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2H-pyrido[1,2-a]quinoxaline-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrido[1,2-a]quinoxaline-3-carboxamide?
The IUPAC name of 2H-pyrido[1,2-a]quinoxaline-3-carboxamide (CID 123210452) is 2H-pyrido[1,2-a]quinoxaline-3-carboxamide.
What is the SMILES notation for 2H-pyrido[1,2-a]quinoxaline-3-carboxamide?
The canonical SMILES for 2H-pyrido[1,2-a]quinoxaline-3-carboxamide is NC(=O)C1=CC2=NC=C3C=CC=CN3C2=CC1.
What is the InChIKey of 2H-pyrido[1,2-a]quinoxaline-3-carboxamide?
The InChIKey is NSVSYQSKOOSKBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N3O/c14-13(17)9-4-5-12-11(7-9)15-8-10-3-1-2-6-16(10)12/h1-3,5-8H,4H2,(H2,14,17).
What are the key properties of 2H-pyrido[1,2-a]quinoxaline-3-carboxamide?
2H-pyrido[1,2-a]quinoxaline-3-carboxamide has a molecular weight of 225.25 g/mol, XLogP of 1.37, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrido[1,2-a]quinoxaline-3-carboxamide is sourced from PubChem (CID 123210452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).