C24H28N4O4S — CID 123210602
1-[5-[3-[[4-(2-methoxyethoxy)pyrimidin-2-yl]amino]-5-methylphenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid (PubChem CID 123210602) has the molecular formula C24H28N4O4S and a molecular weight of 468.58 g/mol. Its IUPAC name is 1-[5-[3-[[4-(2-methoxyethoxy)pyrimidin-2-yl]amino]-5-methylphenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[5-[3-[[4-(2-methoxyethoxy)pyrimidin-2-yl]amino]-5-methylphenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 123210602 |
| Molecular Formula | C24H28N4O4S |
| Molecular Weight | 468.58 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 1-[5-[3-[[4-(2-methoxyethoxy)pyrimidin-2-yl]amino]-5-methylphenyl]-1,3-thiazol-2-yl]cyclohexane-1-carboxylic acid |
| SMILES | COCCOc1ccnc(Nc2cc(C)cc(-c3cnc(C4(C(=O)O)CCCCC4)s3)c2)n1 |
| InChI | InChI=1S/C24H28N4O4S/c1-16-12-17(19-15-26-21(33-19)24(22(29)30)7-4-3-5-8-24)14-18(13-16)27-23-25-9-6-20(28-23)32-11-10-31-2/h6,9,12-15H,3-5,7-8,10-11H2,1-2H3,(H,29,30)(H,25,27,28) |
| InChIKey | WAQJGAHXUZNFOA-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 106.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.58 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|