C13H20F3N7O2 — CID 123210887
N-[1-[5-amino-6-hydrazinyl-2-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]pyrrolidin-3-yl]acetamide (PubChem CID 123210887) has the molecular formula C13H20F3N7O2 and a molecular weight of 363.34 g/mol. Its IUPAC name is N-[1-[5-amino-6-hydrazinyl-2-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]pyrrolidin-3-yl]acetamide.
| Compound Name | N-[1-[5-amino-6-hydrazinyl-2-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]pyrrolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 123210887 |
| Molecular Formula | C13H20F3N7O2 |
| Molecular Weight | 363.34 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | N-[1-[5-amino-6-hydrazinyl-2-(1,1,1-trifluoropropan-2-yloxy)pyrimidin-4-yl]pyrrolidin-3-yl]acetamide |
| SMILES | CC(=O)NC1CCN(c2nc(OC(C)C(F)(F)F)nc(NN)c2N)C1 |
| InChI | InChI=1S/C13H20F3N7O2/c1-6(13(14,15)16)25-12-20-10(22-18)9(17)11(21-12)23-4-3-8(5-23)19-7(2)24/h6,8H,3-5,17-18H2,1-2H3,(H,19,24)(H,20,21,22) |
| InChIKey | IWBNPCCGNQROSM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 131.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.34 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|