C30H46F4O4 — CID 123211083
2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;3,4-diethyl-3-fluoro-1-methylcyclopentan-1-ol;4,5-dimethylcyclopentane-1,3-dione (PubChem CID 123211083) has the molecular formula C30H46F4O4 and a molecular weight of 546.69 g/mol. Its IUPAC name is 2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;3,4-diethyl-3-fluoro-1-methylcyclopentan-1-ol;4,5-dimethylcyclopentane-1,3-dione.
| Compound Name | 2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;3,4-diethyl-3-fluoro-1-methylcyclopentan-1-ol;4,5-dimethylcyclopentane-1,3-dione |
|---|---|
| PubChem CID | 123211083 |
| Molecular Formula | C30H46F4O4 |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.33 |
| IUPAC Name | 2-(4-butan-2-ylphenyl)-1,1,1-trifluoropropan-2-ol;3,4-diethyl-3-fluoro-1-methylcyclopentan-1-ol;4,5-dimethylcyclopentane-1,3-dione |
| SMILES | CC1C(=O)CC(=O)C1C.CCC(C)c1ccc(C(C)(O)C(F)(F)F)cc1.CCC1CC(C)(O)CC1(F)CC |
| InChI | InChI=1S/C13H17F3O.C10H19FO.C7H10O2/c1-4-9(2)10-5-7-11(8-6-10)12(3,17)13(14,15)16;1-4-8-6-9(3,12)7-10(8,11)5-2;1-4-5(2)7(9)3-6(4)8/h5-9,17H,4H2,1-3H3;8,12H,4-7H2,1-3H3;4-5H,3H2,1-2H3 |
| InChIKey | APBHENCMBCVPKR-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|