C14H18N6 — CID 123211317
N'-benzyl-N-hydrazinylidene-2-imino-2-(2-iminocyclopentyl)ethanimidamide (PubChem CID 123211317) has the molecular formula C14H18N6 and a molecular weight of 270.34 g/mol. Its IUPAC name is N'-benzyl-N-hydrazinylidene-2-imino-2-(2-iminocyclopentyl)ethanimidamide.
| Compound Name | N'-benzyl-N-hydrazinylidene-2-imino-2-(2-iminocyclopentyl)ethanimidamide |
|---|---|
| PubChem CID | 123211317 |
| Molecular Formula | C14H18N6 |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | N'-benzyl-N-hydrazinylidene-2-imino-2-(2-iminocyclopentyl)ethanimidamide |
| SMILES | [H]/N=C(C(=N\Cc1ccccc1)\N=N\N)/C1CCC/C1=N\[H] |
| InChI | InChI=1S/C14H18N6/c15-12-8-4-7-11(12)13(16)14(19-20-17)18-9-10-5-2-1-3-6-10/h1-3,5-6,11,15-16H,4,7-9H2,(H2,17,18,19)/b15-12+,16-13- |
| InChIKey | ADXQIXHWJKWBMA-SWPSDAPNSA-N |
| XLogP | 2.75 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|