About 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol
3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol (PubChem CID 123211511) has the molecular formula C16H28N2S2
and a molecular weight of 312.55 g/mol. Its IUPAC name is 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol.
Molecular Properties
| Compound Name | 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol |
| PubChem CID | 123211511 |
| Molecular Formula | C16H28N2S2 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol |
| SMILES | C=C(C)C=CC(=CC)N1CCN(CSCCCS)CC1 |
| InChI | InChI=1S/C16H28N2S2/c1-4-16(7-6-15(2)3)18-10-8-17(9-11-18)14-20-13-5-12-19/h4,6-7,19H,2,5,8-14H2,1,3H3 |
| InChIKey | SCYGPMAVSQFLJP-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 6.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol?
The IUPAC name of 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol (CID 123211511) is 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol.
What is the SMILES notation for 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol?
The canonical SMILES for 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol is C=C(C)C=CC(=CC)N1CCN(CSCCCS)CC1.
What is the InChIKey of 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol?
The InChIKey is SCYGPMAVSQFLJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28N2S2/c1-4-16(7-6-15(2)3)18-10-8-17(9-11-18)14-20-13-5-12-19/h4,6-7,19H,2,5,8-14H2,1,3H3.
What are the key properties of 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol?
3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol has a molecular weight of 312.55 g/mol, XLogP of 3.65, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-(6-methylhepta-2,4,6-trien-3-yl)piperazin-1-yl]methylsulfanyl]propane-1-thiol is sourced from PubChem (CID 123211511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).