About 2-chloro-N-methylhexa-2,4-dien-1-amine
2-chloro-N-methylhexa-2,4-dien-1-amine (PubChem CID 123212746) has the molecular formula C7H12ClN
and a molecular weight of 145.63 g/mol. Its IUPAC name is 2-chloro-N-methylhexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | 2-chloro-N-methylhexa-2,4-dien-1-amine |
| PubChem CID | 123212746 |
| Molecular Formula | C7H12ClN |
| Molecular Weight | 145.63 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | 2-chloro-N-methylhexa-2,4-dien-1-amine |
| SMILES | CC=CC=C(Cl)CNC |
| InChI | InChI=1S/C7H12ClN/c1-3-4-5-7(8)6-9-2/h3-5,9H,6H2,1-2H3 |
| InChIKey | ZZJGTYJTMOXIEL-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.63 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-N-methylhexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-methylhexa-2,4-dien-1-amine?
The IUPAC name of 2-chloro-N-methylhexa-2,4-dien-1-amine (CID 123212746) is 2-chloro-N-methylhexa-2,4-dien-1-amine.
What is the SMILES notation for 2-chloro-N-methylhexa-2,4-dien-1-amine?
The canonical SMILES for 2-chloro-N-methylhexa-2,4-dien-1-amine is CC=CC=C(Cl)CNC.
What is the InChIKey of 2-chloro-N-methylhexa-2,4-dien-1-amine?
The InChIKey is ZZJGTYJTMOXIEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClN/c1-3-4-5-7(8)6-9-2/h3-5,9H,6H2,1-2H3.
What are the key properties of 2-chloro-N-methylhexa-2,4-dien-1-amine?
2-chloro-N-methylhexa-2,4-dien-1-amine has a molecular weight of 145.63 g/mol, XLogP of 1.90, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-methylhexa-2,4-dien-1-amine is sourced from PubChem (CID 123212746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).