C18H30N2 — CID 123212870
7-(4-methylpent-2-en-3-yl)-3-propan-2-yl-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole (PubChem CID 123212870) has the molecular formula C18H30N2 and a molecular weight of 274.45 g/mol. Its IUPAC name is 7-(4-methylpent-2-en-3-yl)-3-propan-2-yl-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole.
| Compound Name | 7-(4-methylpent-2-en-3-yl)-3-propan-2-yl-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole |
|---|---|
| PubChem CID | 123212870 |
| Molecular Formula | C18H30N2 |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.24 |
| IUPAC Name | 7-(4-methylpent-2-en-3-yl)-3-propan-2-yl-4,5,6,7,8,9-hexahydro-1H-cycloocta[d]pyrazole |
| SMILES | CC=C(C(C)C)C1CCCc2c(C(C)C)n[nH]c2CC1 |
| InChI | InChI=1S/C18H30N2/c1-6-15(12(2)3)14-8-7-9-16-17(11-10-14)19-20-18(16)13(4)5/h6,12-14H,7-11H2,1-5H3,(H,19,20) |
| InChIKey | BSLFSHCHCUCNEA-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|