C15H24N2O4S — CID 123213356
1-acetamido-N-(1-methylcyclopropyl)sulfonyl-2-pent-1-enylcyclopropane-1-carboxamide (PubChem CID 123213356) has the molecular formula C15H24N2O4S and a molecular weight of 328.43 g/mol. Its IUPAC name is 1-acetamido-N-(1-methylcyclopropyl)sulfonyl-2-pent-1-enylcyclopropane-1-carboxamide.
| Compound Name | 1-acetamido-N-(1-methylcyclopropyl)sulfonyl-2-pent-1-enylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 123213356 |
| Molecular Formula | C15H24N2O4S |
| Molecular Weight | 328.43 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 1-acetamido-N-(1-methylcyclopropyl)sulfonyl-2-pent-1-enylcyclopropane-1-carboxamide |
| SMILES | CCCC=CC1CC1(NC(C)=O)C(=O)NS(=O)(=O)C1(C)CC1 |
| InChI | InChI=1S/C15H24N2O4S/c1-4-5-6-7-12-10-15(12,16-11(2)18)13(19)17-22(20,21)14(3)8-9-14/h6-7,12H,4-5,8-10H2,1-3H3,(H,16,18)(H,17,19) |
| InChIKey | ROMZDDSHLYQAOC-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|