C22H52O14Si8 — CID 123213428
3-(1,3,7,9,11,13,15-heptaethyl-7-hydroxy-2,4,6,8,10,12,14,16,17,18,19-undecaoxa-1,3,5,7,9,11,13,15-octasilatetracyclo[9.5.1.13,9.15,15]nonadecan-5-yl)propyl 2-methylbutanoate (PubChem CID 123213428) has the molecular formula C22H52O14Si8 and a molecular weight of 765.33 g/mol. Its IUPAC name is 3-(1,3,7,9,11,13,15-heptaethyl-7-hydroxy-2,4,6,8,10,12,14,16,17,18,19-undecaoxa-1,3,5,7,9,11,13,15-octasilatetracyclo[9.5.1.13,9.15,15]nonadecan-5-yl)propyl 2-methylbutanoate.
| Compound Name | 3-(1,3,7,9,11,13,15-heptaethyl-7-hydroxy-2,4,6,8,10,12,14,16,17,18,19-undecaoxa-1,3,5,7,9,11,13,15-octasilatetracyclo[9.5.1.13,9.15,15]nonadecan-5-yl)propyl 2-methylbutanoate |
|---|---|
| PubChem CID | 123213428 |
| Molecular Formula | C22H52O14Si8 |
| Molecular Weight | 765.33 g/mol |
| Exact Mass | 764.15 |
| IUPAC Name | 3-(1,3,7,9,11,13,15-heptaethyl-7-hydroxy-2,4,6,8,10,12,14,16,17,18,19-undecaoxa-1,3,5,7,9,11,13,15-octasilatetracyclo[9.5.1.13,9.15,15]nonadecan-5-yl)propyl 2-methylbutanoate |
| SMILES | CCC(C)C(=O)OCCC[Si]12O[Si](O)(CC)O[Si]3(CC)O[Si]4(CC)O[SiH](CC)O[Si](CC)(O1)O[Si](CC)(O4)O[Si](CC)(O3)O2 |
| InChI | InChI=1S/C22H52O14Si8/c1-10-21(9)22(23)25-19-18-20-44-29-38(24,12-3)28-41(15-6)30-39(13-4)26-37(11-2)27-40(14-5,33-44)32-42(16-7,31-39)35-43(17-8,34-41)36-44/h21,24,37H,10-20H2,1-9H3 |
| InChIKey | ACYVYYHJKJUOHC-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 148.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 765.33 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|