C29H40N8O3 — CID 123213504
[[8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]purin-2-yl]-aminomethylidene]carbamic acid (PubChem CID 123213504) has the molecular formula C29H40N8O3 and a molecular weight of 548.69 g/mol. Its IUPAC name is [[8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]purin-2-yl]-aminomethylidene]carbamic acid.
| Compound Name | [[8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]purin-2-yl]-aminomethylidene]carbamic acid |
|---|---|
| PubChem CID | 123213504 |
| Molecular Formula | C29H40N8O3 |
| Molecular Weight | 548.69 g/mol |
| Exact Mass | 548.32 |
| IUPAC Name | [[8-(3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-4-yl)-6-(1-cyclobutylethylamino)-7-[(4-ethynylcyclohexyl)methyl]purin-2-yl]-aminomethylidene]carbamic acid |
| SMILES | C#CC1CCC(Cn2c(N3CCOC4CCCC43)nc3nc(C(N)=NC(=O)O)nc(NC(C)C4CCC4)c32)CC1 |
| InChI | InChI=1S/C29H40N8O3/c1-3-18-10-12-19(13-11-18)16-37-23-25(31-17(2)20-6-4-7-20)33-27(24(30)32-29(38)39)34-26(23)35-28(37)36-14-15-40-22-9-5-8-21(22)36/h1,17-22H,4-16H2,2H3,(H2,30,32)(H,38,39)(H,31,33,34) |
| InChIKey | FWICHBMNTZVCIN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 143.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.69 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|