C10H14F5N5 — CID 123214339
4-ethyl-N,1-dimethyl-N-(methyldiazenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-amine (PubChem CID 123214339) has the molecular formula C10H14F5N5 and a molecular weight of 299.25 g/mol. Its IUPAC name is 4-ethyl-N,1-dimethyl-N-(methyldiazenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-amine.
| Compound Name | 4-ethyl-N,1-dimethyl-N-(methyldiazenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-amine |
|---|---|
| PubChem CID | 123214339 |
| Molecular Formula | C10H14F5N5 |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 299.12 |
| IUPAC Name | 4-ethyl-N,1-dimethyl-N-(methyldiazenyl)-3-(1,1,2,2,2-pentafluoroethyl)pyrazol-5-amine |
| SMILES | CCc1c(C(F)(F)C(F)(F)F)nn(C)c1N(C)/N=N/C |
| InChI | InChI=1S/C10H14F5N5/c1-5-6-7(9(11,12)10(13,14)15)17-19(3)8(6)20(4)18-16-2/h5H2,1-4H3/b18-16+ |
| InChIKey | WIGWNJRHMYXIQW-FBMGVBCBSA-N |
| XLogP | 3.07 |
| TPSA | 45.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|