About 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide
5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide (PubChem CID 123214837) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide.
Molecular Properties
| Compound Name | 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide |
| PubChem CID | 123214837 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide |
| SMILES | CNC(=O)c1cc(COC)sn1 |
| InChI | InChI=1S/C7H10N2O2S/c1-8-7(10)6-3-5(4-11-2)12-9-6/h3H,4H2,1-2H3,(H,8,10) |
| InChIKey | KEWSOZULEOIBCZ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide?
The IUPAC name of 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide (CID 123214837) is 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide.
What is the SMILES notation for 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide?
The canonical SMILES for 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide is CNC(=O)c1cc(COC)sn1.
What is the InChIKey of 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide?
The InChIKey is KEWSOZULEOIBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-8-7(10)6-3-5(4-11-2)12-9-6/h3H,4H2,1-2H3,(H,8,10).
What are the key properties of 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide?
5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide has a molecular weight of 186.24 g/mol, XLogP of 0.65, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(methoxymethyl)-N-methyl-1,2-thiazole-3-carboxamide is sourced from PubChem (CID 123214837), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).