C28H23F3N4O2 — CID 123214881
N-(4-isocyanophenyl)-N-(oxan-4-ylmethyl)-3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyridine-5-carboxamide (PubChem CID 123214881) has the molecular formula C28H23F3N4O2 and a molecular weight of 504.51 g/mol. Its IUPAC name is N-(4-isocyanophenyl)-N-(oxan-4-ylmethyl)-3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyridine-5-carboxamide.
| Compound Name | N-(4-isocyanophenyl)-N-(oxan-4-ylmethyl)-3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 123214881 |
| Molecular Formula | C28H23F3N4O2 |
| Molecular Weight | 504.51 g/mol |
| Exact Mass | 504.18 |
| IUPAC Name | N-(4-isocyanophenyl)-N-(oxan-4-ylmethyl)-3-[4-(trifluoromethyl)phenyl]pyrazolo[1,5-a]pyridine-5-carboxamide |
| SMILES | [C-]#[N+]c1ccc(N(CC2CCOCC2)C(=O)c2ccn3ncc(-c4ccc(C(F)(F)F)cc4)c3c2)cc1 |
| InChI | InChI=1S/C28H23F3N4O2/c1-32-23-6-8-24(9-7-23)34(18-19-11-14-37-15-12-19)27(36)21-10-13-35-26(16-21)25(17-33-35)20-2-4-22(5-3-20)28(29,30)31/h2-10,13,16-17,19H,11-12,14-15,18H2 |
| InChIKey | MXCHOZKDYQRVIV-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 51.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.51 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|