About 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one
7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one (PubChem CID 123214978) has the molecular formula C10H12O3
and a molecular weight of 180.20 g/mol. Its IUPAC name is 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one.
Molecular Properties
| Compound Name | 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one |
| PubChem CID | 123214978 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one |
| SMILES | C=C1OC2(CCCC2)OC(=O)C1=C |
| InChI | InChI=1S/C10H12O3/c1-7-8(2)12-10(13-9(7)11)5-3-4-6-10/h1-6H2 |
| InChIKey | UHKTZRRVXNMBSG-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one?
The IUPAC name of 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one (CID 123214978) is 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one.
What is the SMILES notation for 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one?
The canonical SMILES for 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one is C=C1OC2(CCCC2)OC(=O)C1=C.
What is the InChIKey of 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one?
The InChIKey is UHKTZRRVXNMBSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O3/c1-7-8(2)12-10(13-9(7)11)5-3-4-6-10/h1-6H2.
What are the key properties of 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one?
7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one has a molecular weight of 180.20 g/mol, XLogP of 1.90, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-dimethylidene-6,10-dioxaspiro[4.5]decan-9-one is sourced from PubChem (CID 123214978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).