C19H19N5O3 — CID 123215530
1-(3H-benzimidazol-5-yl)-4-(3-methylbutanoyl)-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione (PubChem CID 123215530) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 1-(3H-benzimidazol-5-yl)-4-(3-methylbutanoyl)-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione.
| Compound Name | 1-(3H-benzimidazol-5-yl)-4-(3-methylbutanoyl)-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 123215530 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-(3H-benzimidazol-5-yl)-4-(3-methylbutanoyl)-5-(1H-pyrazol-5-yl)pyrrolidine-2,3-dione |
| SMILES | CC(C)CC(=O)C1C(=O)C(=O)N(c2ccc3nc[nH]c3c2)C1c1ccn[nH]1 |
| InChI | InChI=1S/C19H19N5O3/c1-10(2)7-15(25)16-17(13-5-6-22-23-13)24(19(27)18(16)26)11-3-4-12-14(8-11)21-9-20-12/h3-6,8-10,16-17H,7H2,1-2H3,(H,20,21)(H,22,23) |
| InChIKey | NAALLFAWPXLQLO-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 111.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|