C23H39ClN6O2 — CID 123215879
3,3-diamino-N-(6-chloro-4-methoxypiperidin-3-yl)-2-[6-(cyanomethyl)-1-ethyl-4,8-dimethyl-4-azabicyclo[6.1.0]non-5-en-3-yl]propanamide (PubChem CID 123215879) has the molecular formula C23H39ClN6O2 and a molecular weight of 467.06 g/mol. Its IUPAC name is 3,3-diamino-N-(6-chloro-4-methoxypiperidin-3-yl)-2-[6-(cyanomethyl)-1-ethyl-4,8-dimethyl-4-azabicyclo[6.1.0]non-5-en-3-yl]propanamide.
| Compound Name | 3,3-diamino-N-(6-chloro-4-methoxypiperidin-3-yl)-2-[6-(cyanomethyl)-1-ethyl-4,8-dimethyl-4-azabicyclo[6.1.0]non-5-en-3-yl]propanamide |
|---|---|
| PubChem CID | 123215879 |
| Molecular Formula | C23H39ClN6O2 |
| Molecular Weight | 467.06 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | 3,3-diamino-N-(6-chloro-4-methoxypiperidin-3-yl)-2-[6-(cyanomethyl)-1-ethyl-4,8-dimethyl-4-azabicyclo[6.1.0]non-5-en-3-yl]propanamide |
| SMILES | CCC12CC(C(C(=O)NC3CNC(Cl)CC3OC)C(N)N)N(C)C=C(CC#N)CC1(C)C2 |
| InChI | InChI=1S/C23H39ClN6O2/c1-5-23-10-16(30(3)12-14(6-7-25)9-22(23,2)13-23)19(20(26)27)21(31)29-15-11-28-18(24)8-17(15)32-4/h12,15-20,28H,5-6,8-11,13,26-27H2,1-4H3,(H,29,31) |
| InChIKey | PZQHGOZXQUPCIU-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 129.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.06 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|