C19H22N4O3S — CID 123216114
4-[1-[[5-[3-(oxetan-3-ylimino)propanimidoyl]-1,3-benzothiazol-7-yl]oxy]ethyl]pyrrolidin-2-one (PubChem CID 123216114) has the molecular formula C19H22N4O3S and a molecular weight of 386.48 g/mol. Its IUPAC name is 4-[1-[[5-[3-(oxetan-3-ylimino)propanimidoyl]-1,3-benzothiazol-7-yl]oxy]ethyl]pyrrolidin-2-one.
| Compound Name | 4-[1-[[5-[3-(oxetan-3-ylimino)propanimidoyl]-1,3-benzothiazol-7-yl]oxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123216114 |
| Molecular Formula | C19H22N4O3S |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 4-[1-[[5-[3-(oxetan-3-ylimino)propanimidoyl]-1,3-benzothiazol-7-yl]oxy]ethyl]pyrrolidin-2-one |
| SMILES | [H]/N=C(\C/C=N/C1COC1)c1cc(OC(C)C2CNC(=O)C2)c2scnc2c1 |
| InChI | InChI=1S/C19H22N4O3S/c1-11(13-6-18(24)22-7-13)26-17-5-12(4-16-19(17)27-10-23-16)15(20)2-3-21-14-8-25-9-14/h3-5,10-11,13-14,20H,2,6-9H2,1H3,(H,22,24)/b20-15+,21-3+ |
| InChIKey | IVHKKNKGEZGJSU-TXESMMSPSA-N |
| XLogP | 2.43 |
| TPSA | 96.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|