C9H16N2 — CID 123216675
2-N,3-dimethyl-1-N-propan-2-ylbut-3-ene-1,2-diimine (PubChem CID 123216675) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is 2-N,3-dimethyl-1-N-propan-2-ylbut-3-ene-1,2-diimine.
| Compound Name | 2-N,3-dimethyl-1-N-propan-2-ylbut-3-ene-1,2-diimine |
|---|---|
| PubChem CID | 123216675 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 2-N,3-dimethyl-1-N-propan-2-ylbut-3-ene-1,2-diimine |
| SMILES | C=C(C)C(/C=N/C(C)C)=N\C |
| InChI | InChI=1S/C9H16N2/c1-7(2)9(10-5)6-11-8(3)4/h6,8H,1H2,2-5H3/b10-9-,11-6+ |
| InChIKey | VWVFIFVPOOTVPP-AOXGIJKRSA-N |
| XLogP | 2.11 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|