About N-ethylhex-4-en-3-imine
N-ethylhex-4-en-3-imine (PubChem CID 123216726) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is N-ethylhex-4-en-3-imine.
Molecular Properties
| Compound Name | N-ethylhex-4-en-3-imine |
| PubChem CID | 123216726 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | N-ethylhex-4-en-3-imine |
| SMILES | CC=C/C(CC)=N/CC |
| InChI | InChI=1S/C8H15N/c1-4-7-8(5-2)9-6-3/h4,7H,5-6H2,1-3H3/b7-4?,9-8+ |
| InChIKey | MYJAYSNDDQFHRY-KMAKVMIOSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethylhex-4-en-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethylhex-4-en-3-imine?
The IUPAC name of N-ethylhex-4-en-3-imine (CID 123216726) is N-ethylhex-4-en-3-imine.
What is the SMILES notation for N-ethylhex-4-en-3-imine?
The canonical SMILES for N-ethylhex-4-en-3-imine is CC=C/C(CC)=N/CC.
What is the InChIKey of N-ethylhex-4-en-3-imine?
The InChIKey is MYJAYSNDDQFHRY-KMAKVMIOSA-N. The full InChI is InChI=1S/C8H15N/c1-4-7-8(5-2)9-6-3/h4,7H,5-6H2,1-3H3/b7-4?,9-8+.
What are the key properties of N-ethylhex-4-en-3-imine?
N-ethylhex-4-en-3-imine has a molecular weight of 125.21 g/mol, XLogP of 2.43, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethylhex-4-en-3-imine is sourced from PubChem (CID 123216726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).