C27H30FNO6 — CID 123217031
4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one (PubChem CID 123217031) has the molecular formula C27H30FNO6 and a molecular weight of 483.54 g/mol. Its IUPAC name is 4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one.
| Compound Name | 4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
|---|---|
| PubChem CID | 123217031 |
| Molecular Formula | C27H30FNO6 |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.21 |
| IUPAC Name | 4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-dien-15-one |
| SMILES | CC1=CC23C(=O)C(C=C(CO)C(O)C2(O)C1Oc1noc2cccc(F)c12)C1C(CC3C)C1(C)C |
| InChI | InChI=1S/C27H30FNO6/c1-12-10-26-13(2)8-16-20(25(16,3)4)15(22(26)32)9-14(11-30)21(31)27(26,33)23(12)34-24-19-17(28)6-5-7-18(19)35-29-24/h5-7,9-10,13,15-16,20-21,23,30-31,33H,8,11H2,1-4H3 |
| InChIKey | BCXLHUZVZWFNPA-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|