About 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide
3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide (PubChem CID 123217618) has the molecular formula C20H15BrClF2NO3
and a molecular weight of 470.70 g/mol. Its IUPAC name is 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide |
| PubChem CID | 123217618 |
| Molecular Formula | C20H15BrClF2NO3 |
| Molecular Weight | 470.70 g/mol |
| Exact Mass | 468.99 |
| IUPAC Name | 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide |
| SMILES | CCC(Oc1ccc(F)c(C(N)=O)c1F)c1cc(-c2ccc(Cl)cc2)c(Br)o1 |
| InChI | InChI=1S/C20H15BrClF2NO3/c1-2-14(27-15-8-7-13(23)17(18(15)24)20(25)26)16-9-12(19(21)28-16)10-3-5-11(22)6-4-10/h3-9,14H,2H2,1H3,(H2,25,26) |
| InChIKey | WAOCPHKUBJDMSB-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 470.70 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide?
The IUPAC name of 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide (CID 123217618) is 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide.
What is the SMILES notation for 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide?
The canonical SMILES for 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide is CCC(Oc1ccc(F)c(C(N)=O)c1F)c1cc(-c2ccc(Cl)cc2)c(Br)o1.
What is the InChIKey of 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide?
The InChIKey is WAOCPHKUBJDMSB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15BrClF2NO3/c1-2-14(27-15-8-7-13(23)17(18(15)24)20(25)26)16-9-12(19(21)28-16)10-3-5-11(22)6-4-10/h3-9,14H,2H2,1H3,(H2,25,26).
What are the key properties of 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide?
3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide has a molecular weight of 470.70 g/mol, XLogP of 6.27, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1-[5-bromo-4-(4-chlorophenyl)furan-2-yl]propoxy]-2,6-difluorobenzamide is sourced from PubChem (CID 123217618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).