C42H64Si4 — CID 123218086
tris(2,4-dimethyl-3-trimethylsilylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane (PubChem CID 123218086) has the molecular formula C42H64Si4 and a molecular weight of 681.32 g/mol. Its IUPAC name is tris(2,4-dimethyl-3-trimethylsilylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane.
| Compound Name | tris(2,4-dimethyl-3-trimethylsilylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
|---|---|
| PubChem CID | 123218086 |
| Molecular Formula | C42H64Si4 |
| Molecular Weight | 681.32 g/mol |
| Exact Mass | 680.41 |
| IUPAC Name | tris(2,4-dimethyl-3-trimethylsilylphenyl)-(2,3,4,5-tetramethylcyclopenta-1,3-dien-1-yl)silane |
| SMILES | CC1=C(C)C(C)C([Si](c2ccc(C)c([Si](C)(C)C)c2C)(c2ccc(C)c([Si](C)(C)C)c2C)c2ccc(C)c([Si](C)(C)C)c2C)=C1C |
| InChI | InChI=1S/C42H64Si4/c1-26-20-23-36(33(8)39(26)43(11,12)13)46(42-31(6)29(4)30(5)32(42)7,37-24-21-27(2)40(34(37)9)44(14,15)16)38-25-22-28(3)41(35(38)10)45(17,18)19/h20-25,31H,1-19H3 |
| InChIKey | SOFFYMMCAQJZJZ-UHFFFAOYSA-N |
| XLogP | 8.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.32 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|