C22H29FN2O — CID 123218133
N-(2-fluoro-2-prop-1-en-2-ylpent-3-enyl)-1-(6-methylideneocta-2,4-dien-4-yl)pyrrole-3-carboxamide (PubChem CID 123218133) has the molecular formula C22H29FN2O and a molecular weight of 356.49 g/mol. Its IUPAC name is N-(2-fluoro-2-prop-1-en-2-ylpent-3-enyl)-1-(6-methylideneocta-2,4-dien-4-yl)pyrrole-3-carboxamide.
| Compound Name | N-(2-fluoro-2-prop-1-en-2-ylpent-3-enyl)-1-(6-methylideneocta-2,4-dien-4-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 123218133 |
| Molecular Formula | C22H29FN2O |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-(2-fluoro-2-prop-1-en-2-ylpent-3-enyl)-1-(6-methylideneocta-2,4-dien-4-yl)pyrrole-3-carboxamide |
| SMILES | C=C(C=C(C=CC)n1ccc(C(=O)NCC(F)(C=CC)C(=C)C)c1)CC |
| InChI | InChI=1S/C22H29FN2O/c1-7-10-20(14-18(6)9-3)25-13-11-19(15-25)21(26)24-16-22(23,12-8-2)17(4)5/h7-8,10-15H,4,6,9,16H2,1-3,5H3,(H,24,26) |
| InChIKey | BDBNNCRAZFPNQO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|