C16H14N2 — CID 123218507
1,2,3,4-tetrahydrophenanthro[9,10-b]pyrazine (PubChem CID 123218507) has the molecular formula C16H14N2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1,2,3,4-tetrahydrophenanthro[9,10-b]pyrazine.
| Compound Name | 1,2,3,4-tetrahydrophenanthro[9,10-b]pyrazine |
|---|---|
| PubChem CID | 123218507 |
| Molecular Formula | C16H14N2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | 1,2,3,4-tetrahydrophenanthro[9,10-b]pyrazine |
| SMILES | c1ccc2c(c1)c1c(c3ccccc32)NCCN1 |
| InChI | InChI=1S/C16H14N2/c1-3-7-13-11(5-1)12-6-2-4-8-14(12)16-15(13)17-9-10-18-16/h1-8,17-18H,9-10H2 |
| InChIKey | PZSJGLZUUIUSSK-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|