C30H35F3N4O2 — CID 123218701
N-methyl-1-(2-methylphenyl)-N-[[4-methyl-6-(trifluoromethyl)-2-pyridinyl]methyl]-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 123218701) has the molecular formula C30H35F3N4O2 and a molecular weight of 540.63 g/mol. Its IUPAC name is N-methyl-1-(2-methylphenyl)-N-[[4-methyl-6-(trifluoromethyl)-2-pyridinyl]methyl]-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-methyl-1-(2-methylphenyl)-N-[[4-methyl-6-(trifluoromethyl)-2-pyridinyl]methyl]-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 123218701 |
| Molecular Formula | C30H35F3N4O2 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.27 |
| IUPAC Name | N-methyl-1-(2-methylphenyl)-N-[[4-methyl-6-(trifluoromethyl)-2-pyridinyl]methyl]-6-oxo-7,7-bis(prop-2-enyl)-3,4,8,8a-tetrahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | C=CCC1(CC=C)CC2C(c3ccccc3C)N(C(=O)N(C)Cc3cc(C)cc(C(F)(F)F)n3)CCN2C1=O |
| InChI | InChI=1S/C30H35F3N4O2/c1-6-12-29(13-7-2)18-24-26(23-11-9-8-10-21(23)4)37(15-14-36(24)27(29)38)28(39)35(5)19-22-16-20(3)17-25(34-22)30(31,32)33/h6-11,16-17,24,26H,1-2,12-15,18-19H2,3-5H3 |
| InChIKey | YYMAFOSVFZCFIU-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|