C9H15N3 — CID 123219303
6,8-dimethyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine (PubChem CID 123219303) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is 6,8-dimethyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine.
| Compound Name | 6,8-dimethyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
|---|---|
| PubChem CID | 123219303 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 6,8-dimethyl-5,6,7,9-tetrahydroimidazo[1,5-a][1,4]diazepine |
| SMILES | CC1CN(C)Cc2cncn2C1 |
| InChI | InChI=1S/C9H15N3/c1-8-4-11(2)6-9-3-10-7-12(9)5-8/h3,7-8H,4-6H2,1-2H3 |
| InChIKey | NHKITTSYMKSOPW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |