C22H21N6O+ — CID 123219753
3-diazonioimino-6-[[6-ethyl-2-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-3-oxocyclohexen-1-yl]methylidene]cyclohexa-1,4-diene (PubChem CID 123219753) has the molecular formula C22H21N6O+ and a molecular weight of 385.45 g/mol. Its IUPAC name is 3-diazonioimino-6-[[6-ethyl-2-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-3-oxocyclohexen-1-yl]methylidene]cyclohexa-1,4-diene.
| Compound Name | 3-diazonioimino-6-[[6-ethyl-2-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-3-oxocyclohexen-1-yl]methylidene]cyclohexa-1,4-diene |
|---|---|
| PubChem CID | 123219753 |
| Molecular Formula | C22H21N6O+ |
| Molecular Weight | 385.45 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 3-diazonioimino-6-[[6-ethyl-2-[[4-(iminohydrazinylidene)cyclohexa-2,5-dien-1-ylidene]methyl]-3-oxocyclohexen-1-yl]methylidene]cyclohexa-1,4-diene |
| SMILES | [H]/N=N/N=C1C=CC(=CC2=C(C=C3C=CC(=N[N+]#N)C=C3)C(CC)CCC2=O)C=C1 |
| InChI | InChI=1S/C22H21N6O/c1-2-17-7-12-22(29)21(14-16-5-10-19(11-6-16)26-28-24)20(17)13-15-3-8-18(9-4-15)25-27-23/h3-6,8-11,13-14,17,24H,2,7,12H2,1H3/q+1/b15-13-,16-14-,25-18+,26-19+,28-24+ |
| InChIKey | LZVCLBSIAPQVET-ZHUUDTCVSA-N |
| XLogP | 5.37 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.45 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azo_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|