C20H21BO4 — CID 123219847
2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]xanthen-9-one (PubChem CID 123219847) has the molecular formula C20H21BO4 and a molecular weight of 336.20 g/mol. Its IUPAC name is 2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]xanthen-9-one.
| Compound Name | 2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]xanthen-9-one |
|---|---|
| PubChem CID | 123219847 |
| Molecular Formula | C20H21BO4 |
| Molecular Weight | 336.20 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]xanthen-9-one |
| SMILES | CC1(C)OB(Cc2ccc3oc4ccccc4c(=O)c3c2)OC1(C)C |
| InChI | InChI=1S/C20H21BO4/c1-19(2)20(3,4)25-21(24-19)12-13-9-10-17-15(11-13)18(22)14-7-5-6-8-16(14)23-17/h5-11H,12H2,1-4H3 |
| InChIKey | CKZNIXAVWZMNGY-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.20 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|