About 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one
2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one (PubChem CID 123219911) has the molecular formula C22H21ClO5
and a molecular weight of 400.86 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one.
Molecular Properties
| Compound Name | 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one |
| PubChem CID | 123219911 |
| Molecular Formula | C22H21ClO5 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one |
| SMILES | O=c1cc(-c2ccccc2Cl)oc2c(C3CCCCCC3O)c(O)cc(O)c12 |
| InChI | InChI=1S/C22H21ClO5/c23-14-8-5-4-6-12(14)19-11-18(27)21-17(26)10-16(25)20(22(21)28-19)13-7-2-1-3-9-15(13)24/h4-6,8,10-11,13,15,24-26H,1-3,7,9H2 |
| InChIKey | QQXJUMVHDJQSSP-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one?
The IUPAC name of 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one (CID 123219911) is 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one.
What is the SMILES notation for 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one?
The canonical SMILES for 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one is O=c1cc(-c2ccccc2Cl)oc2c(C3CCCCCC3O)c(O)cc(O)c12.
What is the InChIKey of 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one?
The InChIKey is QQXJUMVHDJQSSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H21ClO5/c23-14-8-5-4-6-12(14)19-11-18(27)21-17(26)10-16(25)20(22(21)28-19)13-7-2-1-3-9-15(13)24/h4-6,8,10-11,13,15,24-26H,1-3,7,9H2.
What are the key properties of 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one?
2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one has a molecular weight of 400.86 g/mol, XLogP of 4.93, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chlorophenyl)-5,7-dihydroxy-8-(2-hydroxycycloheptyl)chromen-4-one is sourced from PubChem (CID 123219911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).