C6H5F5O — CID 123220067
2,3,4,5,6-pentafluorohexa-2,4-dien-1-ol (PubChem CID 123220067) has the molecular formula C6H5F5O and a molecular weight of 188.09 g/mol. Its IUPAC name is 2,3,4,5,6-pentafluorohexa-2,4-dien-1-ol.
| Compound Name | 2,3,4,5,6-pentafluorohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 123220067 |
| Molecular Formula | C6H5F5O |
| Molecular Weight | 188.09 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 2,3,4,5,6-pentafluorohexa-2,4-dien-1-ol |
| SMILES | OCC(F)=C(F)C(F)=C(F)CF |
| InChI | InChI=1S/C6H5F5O/c7-1-3(8)5(10)6(11)4(9)2-12/h12H,1-2H2 |
| InChIKey | ILPGIFNPLGTSDN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.09 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|