About 3,4-dihydropyridine-4,5-diamine
3,4-dihydropyridine-4,5-diamine (PubChem CID 123220143) has the molecular formula C5H9N3
and a molecular weight of 111.15 g/mol. Its IUPAC name is 3,4-dihydropyridine-4,5-diamine.
Molecular Properties
| Compound Name | 3,4-dihydropyridine-4,5-diamine |
| PubChem CID | 123220143 |
| Molecular Formula | C5H9N3 |
| Molecular Weight | 111.15 g/mol |
| Exact Mass | 111.08 |
| IUPAC Name | 3,4-dihydropyridine-4,5-diamine |
| SMILES | NC1=CN=CCC1N |
| InChI | InChI=1S/C5H9N3/c6-4-1-2-8-3-5(4)7/h2-4H,1,6-7H2 |
| InChIKey | RXEXSNLLMUNBPW-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.15 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dihydropyridine-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihydropyridine-4,5-diamine?
The IUPAC name of 3,4-dihydropyridine-4,5-diamine (CID 123220143) is 3,4-dihydropyridine-4,5-diamine.
What is the SMILES notation for 3,4-dihydropyridine-4,5-diamine?
The canonical SMILES for 3,4-dihydropyridine-4,5-diamine is NC1=CN=CCC1N.
What is the InChIKey of 3,4-dihydropyridine-4,5-diamine?
The InChIKey is RXEXSNLLMUNBPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N3/c6-4-1-2-8-3-5(4)7/h2-4H,1,6-7H2.
What are the key properties of 3,4-dihydropyridine-4,5-diamine?
3,4-dihydropyridine-4,5-diamine has a molecular weight of 111.15 g/mol, XLogP of -0.41, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydropyridine-4,5-diamine is sourced from PubChem (CID 123220143), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).