C20H16N2O2S — CID 123220486
4-(2-prop-2-enoxyphenyl)-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one (PubChem CID 123220486) has the molecular formula C20H16N2O2S and a molecular weight of 348.43 g/mol. Its IUPAC name is 4-(2-prop-2-enoxyphenyl)-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one.
| Compound Name | 4-(2-prop-2-enoxyphenyl)-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one |
|---|---|
| PubChem CID | 123220486 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | 4-(2-prop-2-enoxyphenyl)-2-sulfanylidene-4,4a-dihydro-3H-indeno[1,2-d]pyrimidin-5-one |
| SMILES | C=CCOc1ccccc1C1NC(=S)N=C2c3ccccc3C(=O)C21 |
| InChI | InChI=1S/C20H16N2O2S/c1-2-11-24-15-10-6-5-9-14(15)18-16-17(21-20(25)22-18)12-7-3-4-8-13(12)19(16)23/h2-10,16,18H,1,11H2,(H,22,25) |
| InChIKey | UXEHOAMWRQJXHO-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|