C32H28N3O+ — CID 123221207
8-methoxy-5-[4-(1-phenylbenzimidazol-2-yl)phenyl]-1-propylquinolin-1-ium (PubChem CID 123221207) has the molecular formula C32H28N3O+ and a molecular weight of 470.60 g/mol. Its IUPAC name is 8-methoxy-5-[4-(1-phenylbenzimidazol-2-yl)phenyl]-1-propylquinolin-1-ium.
| Compound Name | 8-methoxy-5-[4-(1-phenylbenzimidazol-2-yl)phenyl]-1-propylquinolin-1-ium |
|---|---|
| PubChem CID | 123221207 |
| Molecular Formula | C32H28N3O+ |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | 8-methoxy-5-[4-(1-phenylbenzimidazol-2-yl)phenyl]-1-propylquinolin-1-ium |
| SMILES | CCC[n+]1cccc2c(-c3ccc(-c4nc5ccccc5n4-c4ccccc4)cc3)ccc(OC)c21 |
| InChI | InChI=1S/C32H28N3O/c1-3-21-34-22-9-12-27-26(19-20-30(36-2)31(27)34)23-15-17-24(18-16-23)32-33-28-13-7-8-14-29(28)35(32)25-10-5-4-6-11-25/h4-20,22H,3,21H2,1-2H3/q+1 |
| InChIKey | DVBNBHOILZPWPG-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|