About 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol
2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol (PubChem CID 123221466) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol |
| PubChem CID | 123221466 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol |
| SMILES | CC1=CC=CC(CNCCO)C1 |
| InChI | InChI=1S/C10H17NO/c1-9-3-2-4-10(7-9)8-11-5-6-12/h2-4,10-12H,5-8H2,1H3 |
| InChIKey | JUGOOYWEFKARED-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol?
The IUPAC name of 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol (CID 123221466) is 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol.
What is the SMILES notation for 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol?
The canonical SMILES for 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol is CC1=CC=CC(CNCCO)C1.
What is the InChIKey of 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol?
The InChIKey is JUGOOYWEFKARED-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO/c1-9-3-2-4-10(7-9)8-11-5-6-12/h2-4,10-12H,5-8H2,1H3.
What are the key properties of 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol?
2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol has a molecular weight of 167.25 g/mol, XLogP of 1.09, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methylcyclohexa-2,4-dien-1-yl)methylamino]ethanol is sourced from PubChem (CID 123221466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).