C17H28N+ — CID 123221675
ethylidene-methyl-(3-methyl-6-prop-1-enyldeca-2,4,6-trienyl)azanium (PubChem CID 123221675) has the molecular formula C17H28N+ and a molecular weight of 246.42 g/mol. Its IUPAC name is ethylidene-methyl-(3-methyl-6-prop-1-enyldeca-2,4,6-trienyl)azanium.
| Compound Name | ethylidene-methyl-(3-methyl-6-prop-1-enyldeca-2,4,6-trienyl)azanium |
|---|---|
| PubChem CID | 123221675 |
| Molecular Formula | C17H28N+ |
| Molecular Weight | 246.42 g/mol |
| Exact Mass | 246.22 |
| IUPAC Name | ethylidene-methyl-(3-methyl-6-prop-1-enyldeca-2,4,6-trienyl)azanium |
| SMILES | CC=CC(C=CC(C)=CC/[N+](C)=C/C)=CCCC |
| InChI | InChI=1S/C17H28N/c1-6-9-11-17(10-7-2)13-12-16(4)14-15-18(5)8-3/h7-8,10-14H,6,9,15H2,1-5H3/q+1/b10-7?,13-12?,16-14?,17-11?,18-8+ |
| InChIKey | XDXNKFYOWVZYSS-VWKRAKJSSA-N |
| XLogP | 4.52 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|